C21H19N5O2 — CID 135702756
N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 135702756) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135702756 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H19N5O2/c1-2-26(13-19-22-16-11-7-6-10-15(16)20(27)23-19)21(28)18-12-17(24-25-18)14-8-4-3-5-9-14/h3-12H,2,13H2,1H3,(H,24,25)(H,22,23,27) |
| InChIKey | MYVIKDWTWJMTLQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |