C27H23N5O2 — CID 135876239
N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 135876239) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135876239 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H23N5O2/c1-2-31(18-24-28-23-16-10-9-15-21(23)26(33)29-24)27(34)22-17-32(20-13-7-4-8-14-20)30-25(22)19-11-5-3-6-12-19/h3-17H,2,18H2,1H3,(H,28,29,33) |
| InChIKey | AGJUYAXNKRQNOP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |