C18H19N3O3 — CID 135896382
N,5-diethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide (PubChem CID 135896382) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N,5-diethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N,5-diethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135896382 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N,5-diethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N(CC)Cc2nc3ccccc3c(=O)[nH]2)o1 |
| InChI | InChI=1S/C18H19N3O3/c1-3-12-9-10-15(24-12)18(23)21(4-2)11-16-19-14-8-6-5-7-13(14)17(22)20-16/h5-10H,3-4,11H2,1-2H3,(H,19,20,22) |
| InChIKey | JOEDOSSVSZTPLT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |