C15H20N4O2S — CID 135789913
2-(diethylamino)ethyl (5Z)-N-hydroxy-3-phenyl-1,2,4-oxadiazole-5-carboximidothioate (PubChem CID 135789913) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-phenyl-1,2,4-oxadiazole-5-carboximidothioate.
| Compound Name | 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-phenyl-1,2,4-oxadiazole-5-carboximidothioate |
|---|---|
| PubChem CID | 135789913 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-phenyl-1,2,4-oxadiazole-5-carboximidothioate |
| SMILES | CCN(CC)CCS/C(=N\O)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H20N4O2S/c1-3-19(4-2)10-11-22-15(17-20)14-16-13(18-21-14)12-8-6-5-7-9-12/h5-9,20H,3-4,10-11H2,1-2H3/b17-15- |
| InChIKey | QZIXJLSOJNMYMO-ICFOKQHNSA-N |
| XLogP | 2.95 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|