C34H28Cl2FN5O2S — CID 135793634
7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793634) has the molecular formula C34H28Cl2FN5O2S and a molecular weight of 660.60 g/mol. Its IUPAC name is 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793634 |
| Molecular Formula | C34H28Cl2FN5O2S |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 659.13 |
| IUPAC Name | 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2)C(c2cccc(OCc3ccc(Cl)cc3Cl)c2)n2nc(SCc3ccccc3F)nc2N1 |
| InChI | InChI=1S/C34H28Cl2FN5O2S/c1-20-7-5-10-26(15-20)39-32(43)30-21(2)38-33-40-34(45-19-24-8-3-4-12-29(24)37)41-42(33)31(30)22-9-6-11-27(16-22)44-18-23-13-14-25(35)17-28(23)36/h3-17,31H,18-19H2,1-2H3,(H,39,43)(H,38,40,41) |
| InChIKey | QAXMVIFKICSKCM-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |