C12H20N4O6 — CID 135797433
ethyl N-[(Z)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1H-imidazol-2-yl]ethylideneamino]carbamate (PubChem CID 135797433) has the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is ethyl N-[(Z)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1H-imidazol-2-yl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[(Z)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1H-imidazol-2-yl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 135797433 |
| Molecular Formula | C12H20N4O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethyl N-[(Z)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1H-imidazol-2-yl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C(/C)c1ncc([C@@H](O)[C@H](O)[C@H](O)CO)[nH]1 |
| InChI | InChI=1S/C12H20N4O6/c1-3-22-12(21)16-15-6(2)11-13-4-7(14-11)9(19)10(20)8(18)5-17/h4,8-10,17-20H,3,5H2,1-2H3,(H,13,14)(H,16,21)/b15-6-/t8-,9-,10-/m1/s1 |
| InChIKey | KOMOEBYYFANJKK-CHQMSXHNSA-N |
| XLogP | -1.37 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|