C21H21FN6O — CID 135800446
4-[2-fluoro-4-[(7R)-7-(2-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-5-yl]phenyl]morpholine (PubChem CID 135800446) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[2-fluoro-4-[(7R)-7-(2-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-5-yl]phenyl]morpholine.
| Compound Name | 4-[2-fluoro-4-[(7R)-7-(2-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 135800446 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-[2-fluoro-4-[(7R)-7-(2-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-5-yl]phenyl]morpholine |
| SMILES | Cc1ccccc1[C@H]1C=C(c2ccc(N3CCOCC3)c(F)c2)Nc2nnnn21 |
| InChI | InChI=1S/C21H21FN6O/c1-14-4-2-3-5-16(14)20-13-18(23-21-24-25-26-28(20)21)15-6-7-19(17(22)12-15)27-8-10-29-11-9-27/h2-7,12-13,20H,8-11H2,1H3,(H,23,24,26)/t20-/m1/s1 |
| InChIKey | YVFCDVZADQKMTN-HXUWFJFHSA-N |
| XLogP | 3.01 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|