C16H11FN6O2 — CID 2968242
7-(2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 2968242) has the molecular formula C16H11FN6O2 and a molecular weight of 338.30 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | 7-(2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 2968242 |
| Molecular Formula | C16H11FN6O2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 7-(2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(C2=CC(c3ccccc3F)n3nnnc3N2)c1 |
| InChI | InChI=1S/C16H11FN6O2/c17-13-7-2-1-6-12(13)15-9-14(18-16-19-20-21-22(15)16)10-4-3-5-11(8-10)23(24)25/h1-9,15H,(H,18,19,21) |
| InChIKey | RBKNCSKCRKYQDS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|