C16H10BrFN6O2 — CID 4199077
7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 4199077) has the molecular formula C16H10BrFN6O2 and a molecular weight of 417.20 g/mol. Its IUPAC name is 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 4199077 |
| Molecular Formula | C16H10BrFN6O2 |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 7-(5-bromo-2-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(C2=CC(c3cc(Br)ccc3F)n3nnnc3N2)c1 |
| InChI | InChI=1S/C16H10BrFN6O2/c17-10-4-5-13(18)12(7-10)15-8-14(19-16-20-21-22-23(15)16)9-2-1-3-11(6-9)24(25)26/h1-8,15H,(H,19,20,22) |
| InChIKey | DLXMZEHISMDDSP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|