C18H16N6O4 — CID 136736323
(7R)-7-(2,3-dimethoxyphenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136736323) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is (7R)-7-(2,3-dimethoxyphenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (7R)-7-(2,3-dimethoxyphenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136736323 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (7R)-7-(2,3-dimethoxyphenyl)-5-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| SMILES | COc1cccc([C@H]2C=C(c3cccc([N+](=O)[O-])c3)Nc3nnnn32)c1OC |
| InChI | InChI=1S/C18H16N6O4/c1-27-16-8-4-7-13(17(16)28-2)15-10-14(19-18-20-21-22-23(15)18)11-5-3-6-12(9-11)24(25)26/h3-10,15H,1-2H3,(H,19,20,22)/t15-/m1/s1 |
| InChIKey | NWDDJCBSSHXUIQ-OAHLLOKOSA-N |
| XLogP | 2.65 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|