C17H11ClFN5O2 — CID 136736525
(7S)-7-(2-chloro-6-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136736525) has the molecular formula C17H11ClFN5O2 and a molecular weight of 371.76 g/mol. Its IUPAC name is (7S)-7-(2-chloro-6-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (7S)-7-(2-chloro-6-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136736525 |
| Molecular Formula | C17H11ClFN5O2 |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (7S)-7-(2-chloro-6-fluorophenyl)-5-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(C2=C[C@@H](c3c(F)cccc3Cl)n3ncnc3N2)c1 |
| InChI | InChI=1S/C17H11ClFN5O2/c18-12-5-2-6-13(19)16(12)15-8-14(22-17-20-9-21-23(15)17)10-3-1-4-11(7-10)24(25)26/h1-9,15H,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | WWMVFDUIGQLARG-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|