C18H12F3N5O2 — CID 162537935
7-(4-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 162537935) has the molecular formula C18H12F3N5O2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(4-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 162537935 |
| Molecular Formula | C18H12F3N5O2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 7-(4-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(C2C=C(c3cccc(C(F)(F)F)c3)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C18H12F3N5O2/c19-18(20,21)13-3-1-2-12(8-13)15-9-16(25-17(24-15)22-10-23-25)11-4-6-14(7-5-11)26(27)28/h1-10,16H,(H,22,23,24) |
| InChIKey | JXSAPFWSJPBYHG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|