C24H22N3OS3+ — CID 135801657
(2Z,5Z)-2-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidene)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 135801657) has the molecular formula C24H22N3OS3+ and a molecular weight of 464.66 g/mol. Its IUPAC name is (2Z,5Z)-2-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidene)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidene)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135801657 |
| Molecular Formula | C24H22N3OS3+ |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (2Z,5Z)-2-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidene)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCn1c(=O)/c(=C2/Sc3ccccc3N2C)s/c1=C1/CCC[n+]2c1sc1ccccc12 |
| InChI | InChI=1S/C24H22N3OS3/c1-3-26-21(28)20(24-25(2)16-10-4-6-12-18(16)30-24)31-22(26)15-9-8-14-27-17-11-5-7-13-19(17)29-23(15)27/h4-7,10-13H,3,8-9,14H2,1-2H3/q+1/b24-20- |
| InChIKey | AAEWQWFFDZXEPP-GFMRDNFCSA-N |
| XLogP | 3.73 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|