C23H25BrN6O2 — CID 135805339
7-(5-bromo-2-butoxyphenyl)-5-methyl-N-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135805339) has the molecular formula C23H25BrN6O2 and a molecular weight of 497.40 g/mol. Its IUPAC name is 7-(5-bromo-2-butoxyphenyl)-5-methyl-N-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(5-bromo-2-butoxyphenyl)-5-methyl-N-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135805339 |
| Molecular Formula | C23H25BrN6O2 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 7-(5-bromo-2-butoxyphenyl)-5-methyl-N-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCOc1ccc(Br)cc1C1C(C(=O)Nc2ccc(C)cc2)=C(C)Nc2nnnn21 |
| InChI | InChI=1S/C23H25BrN6O2/c1-4-5-12-32-19-11-8-16(24)13-18(19)21-20(15(3)25-23-27-28-29-30(21)23)22(31)26-17-9-6-14(2)7-10-17/h6-11,13,21H,4-5,12H2,1-3H3,(H,26,31)(H,25,27,29) |
| InChIKey | GMGSYAKHFVXSHG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|