C19H24BrN5O3 — CID 135827215
propyl 7-(5-bromo-2-butoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135827215) has the molecular formula C19H24BrN5O3 and a molecular weight of 450.34 g/mol. Its IUPAC name is propyl 7-(5-bromo-2-butoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propyl 7-(5-bromo-2-butoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135827215 |
| Molecular Formula | C19H24BrN5O3 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | propyl 7-(5-bromo-2-butoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOc1ccc(Br)cc1C1C(C(=O)OCCC)=C(C)Nc2nnnn21 |
| InChI | InChI=1S/C19H24BrN5O3/c1-4-6-10-27-15-8-7-13(20)11-14(15)17-16(18(26)28-9-5-2)12(3)21-19-22-23-24-25(17)19/h7-8,11,17H,4-6,9-10H2,1-3H3,(H,21,22,24) |
| InChIKey | VBYFNZDOBUYUDT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|