C25H28BrN5O4 — CID 135805780
butyl 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805780) has the molecular formula C25H28BrN5O4 and a molecular weight of 542.43 g/mol. Its IUPAC name is butyl 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805780 |
| Molecular Formula | C25H28BrN5O4 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | butyl 7-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2nnnn2C1c1ccc(OCc2ccc(Br)cc2)c(OCC)c1 |
| InChI | InChI=1S/C25H28BrN5O4/c1-4-6-13-34-24(32)22-16(3)27-25-28-29-30-31(25)23(22)18-9-12-20(21(14-18)33-5-2)35-15-17-7-10-19(26)11-8-17/h7-12,14,23H,4-6,13,15H2,1-3H3,(H,27,28,30) |
| InChIKey | YQQWCKLQFVOGBK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|