C19H20BrN3O2 — CID 135808096
2-[[2-(3-bromophenoxy)ethyl-ethylamino]methyl]-3H-quinazolin-4-one (PubChem CID 135808096) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 2-[[2-(3-bromophenoxy)ethyl-ethylamino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[2-(3-bromophenoxy)ethyl-ethylamino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135808096 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[[2-(3-bromophenoxy)ethyl-ethylamino]methyl]-3H-quinazolin-4-one |
| SMILES | CCN(CCOc1cccc(Br)c1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H20BrN3O2/c1-2-23(10-11-25-15-7-5-6-14(20)12-15)13-18-21-17-9-4-3-8-16(17)19(24)22-18/h3-9,12H,2,10-11,13H2,1H3,(H,21,22,24) |
| InChIKey | ZTBAJPNXFJFSOU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |