C23H32N4O4 — CID 135808666
N-[2-(cyclohexen-1-yl)ethyl]-2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethylamino]acetamide (PubChem CID 135808666) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 135808666 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NCCC1=CCCCC1)Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H32N4O4/c1-4-27(15-22(28)24-11-10-16-8-6-5-7-9-16)14-21-25-18-13-20(31-3)19(30-2)12-17(18)23(29)26-21/h8,12-13H,4-7,9-11,14-15H2,1-3H3,(H,24,28)(H,25,26,29) |
| InChIKey | XTLDHKZTUPAEGJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|