C21H18ClN3O2S — CID 135813699
(4Z)-4-[4-(4-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-1-(4-ethoxyphenyl)-5-iminopyrrolidin-2-one (PubChem CID 135813699) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is (4Z)-4-[4-(4-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-1-(4-ethoxyphenyl)-5-iminopyrrolidin-2-one.
| Compound Name | (4Z)-4-[4-(4-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-1-(4-ethoxyphenyl)-5-iminopyrrolidin-2-one |
|---|---|
| PubChem CID | 135813699 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (4Z)-4-[4-(4-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-1-(4-ethoxyphenyl)-5-iminopyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2/NC(c3ccc(Cl)cc3)=CS2)/CC(=O)N/1c1ccc(OCC)cc1 |
| InChI | InChI=1S/C21H18ClN3O2S/c1-2-27-16-9-7-15(8-10-16)25-19(26)11-17(20(25)23)21-24-18(12-28-21)13-3-5-14(22)6-4-13/h3-10,12,23-24H,2,11H2,1H3/b21-17-,23-20- |
| InChIKey | FVADAJPKZOZHNG-VSEXOIBNSA-N |
| XLogP | 5.00 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|