C21H18ClN3O3S — CID 135812406
(4Z)-1-(4-chlorophenyl)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-iminopyrrolidin-2-one (PubChem CID 135812406) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is (4Z)-1-(4-chlorophenyl)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-iminopyrrolidin-2-one.
| Compound Name | (4Z)-1-(4-chlorophenyl)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-iminopyrrolidin-2-one |
|---|---|
| PubChem CID | 135812406 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (4Z)-1-(4-chlorophenyl)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-iminopyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2/NC(c3ccc(OC)c(OC)c3)=CS2)/CC(=O)N/1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-27-17-8-3-12(9-18(17)28-2)16-11-29-21(24-16)15-10-19(26)25(20(15)23)14-6-4-13(22)5-7-14/h3-9,11,23-24H,10H2,1-2H3/b21-15-,23-20- |
| InChIKey | HKPGBAPGRDNROM-OSDOOVJGSA-N |
| XLogP | 4.62 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|