C20H17ClN2O5 — CID 4870628
7-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione (PubChem CID 4870628) has the molecular formula C20H17ClN2O5 and a molecular weight of 400.82 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione.
| Compound Name | 7-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
|---|---|
| PubChem CID | 4870628 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 7-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
| SMILES | COc1ccc(C2=NOC3(CC(=O)N(c4ccc(Cl)cc4)C3=O)C2)cc1OC |
| InChI | InChI=1S/C20H17ClN2O5/c1-26-16-8-3-12(9-17(16)27-2)15-10-20(28-22-15)11-18(24)23(19(20)25)14-6-4-13(21)5-7-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | OQUBBEHABWXFBA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|