C19H22N2O5 — CID 59550970
3-(3-cyclopentyloxy-4-methoxyphenyl)-7-methyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione (PubChem CID 59550970) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-7-methyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-7-methyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
|---|---|
| PubChem CID | 59550970 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-7-methyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
| SMILES | COc1ccc(C2=NOC3(CC(=O)N(C)C3=O)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H22N2O5/c1-21-17(22)11-19(18(21)23)10-14(20-26-19)12-7-8-15(24-2)16(9-12)25-13-5-3-4-6-13/h7-9,13H,3-6,10-11H2,1-2H3 |
| InChIKey | UGBLMZMCOJSTHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|