C19H14Cl2N2O3 — CID 14938698
7-(3,5-dichlorophenyl)-3-(4-methylphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione (PubChem CID 14938698) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is 7-(3,5-dichlorophenyl)-3-(4-methylphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione.
| Compound Name | 7-(3,5-dichlorophenyl)-3-(4-methylphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
|---|---|
| PubChem CID | 14938698 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 7-(3,5-dichlorophenyl)-3-(4-methylphenyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
| SMILES | Cc1ccc(C2=NOC3(CC(=O)N(c4cc(Cl)cc(Cl)c4)C3=O)C2)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-11-2-4-12(5-3-11)16-9-19(26-22-16)10-17(24)23(18(19)25)15-7-13(20)6-14(21)8-15/h2-8H,9-10H2,1H3 |
| InChIKey | WLXGJZCETFTEHR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|