C14H17NO3W — CID 59649933
3-(3,4-dimethoxyphenyl)-5-ethyl-5-methanidyl-4H-1,2-oxazole;tungsten(2+) (PubChem CID 59649933) has the molecular formula C14H17NO3W and a molecular weight of 431.13 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-ethyl-5-methanidyl-4H-1,2-oxazole;tungsten(2+).
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-ethyl-5-methanidyl-4H-1,2-oxazole;tungsten(2+) |
|---|---|
| PubChem CID | 59649933 |
| Molecular Formula | C14H17NO3W |
| Molecular Weight | 431.13 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-ethyl-5-methanidyl-4H-1,2-oxazole;tungsten(2+) |
| SMILES | [CH2-]CC1([CH2-])CC(c2ccc(OC)c(OC)c2)=NO1.[W+2] |
| InChI | InChI=1S/C14H17NO3.W/c1-5-14(2)9-11(15-18-14)10-6-7-12(16-3)13(8-10)17-4;/h6-8H,1-2,5,9H2,3-4H3;/q-2;+2 |
| InChIKey | IUZHXGACHSKFJC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|