C12H16N2O4S — CID 177113747
3-[4-methoxy-3-(sulfinoamino)phenyl]-5,5-dimethyl-4H-1,2-oxazole (PubChem CID 177113747) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[4-methoxy-3-(sulfinoamino)phenyl]-5,5-dimethyl-4H-1,2-oxazole.
| Compound Name | 3-[4-methoxy-3-(sulfinoamino)phenyl]-5,5-dimethyl-4H-1,2-oxazole |
|---|---|
| PubChem CID | 177113747 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-[4-methoxy-3-(sulfinoamino)phenyl]-5,5-dimethyl-4H-1,2-oxazole |
| SMILES | COc1ccc(C2=NOC(C)(C)C2)cc1NS(=O)O |
| InChI | InChI=1S/C12H16N2O4S/c1-12(2)7-10(13-18-12)8-4-5-11(17-3)9(6-8)14-19(15)16/h4-6,14H,7H2,1-3H3,(H,15,16) |
| InChIKey | SYDBBRGUXKZZGY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|