C11H14N2O4S2 — CID 71053977
(4S)-4-[[4-methoxy-3-(sulfinoamino)phenyl]methyl]-2-oxo-1,3-thiazolidine (PubChem CID 71053977) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (4S)-4-[[4-methoxy-3-(sulfinoamino)phenyl]methyl]-2-oxo-1,3-thiazolidine.
| Compound Name | (4S)-4-[[4-methoxy-3-(sulfinoamino)phenyl]methyl]-2-oxo-1,3-thiazolidine |
|---|---|
| PubChem CID | 71053977 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (4S)-4-[[4-methoxy-3-(sulfinoamino)phenyl]methyl]-2-oxo-1,3-thiazolidine |
| SMILES | COc1ccc(C[C@H]2CSC(=O)N2)cc1NS(=O)O |
| InChI | InChI=1S/C11H14N2O4S2/c1-17-10-3-2-7(5-9(10)13-19(15)16)4-8-6-18-11(14)12-8/h2-3,5,8,13H,4,6H2,1H3,(H,12,14)(H,15,16)/t8-/m0/s1 |
| InChIKey | RMUPMETXBMJNJT-QMMMGPOBSA-N |
| XLogP | 1.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|