C12H14AlNO3 — CID 149375552
CID 149375552 (PubChem CID 149375552) has the molecular formula C12H14AlNO3 and a molecular weight of 247.23 g/mol.
| Compound Name | CID 149375552 |
|---|---|
| PubChem CID | 149375552 |
| Molecular Formula | C12H14AlNO3 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | — |
| SMILES | COc1ccc(CC2COCC(=O)N2)cc1[Al] |
| InChI | InChI=1S/C12H14NO3.Al/c1-15-11-4-2-9(3-5-11)6-10-7-16-8-12(14)13-10;/h2-4,10H,6-8H2,1H3,(H,13,14); |
| InChIKey | SJKNBKCLDFRPNZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |