C10H12ClN5 — CID 135815410
2-chloro-N-(3-methylbut-2-enyl)-3,5-dihydropurin-6-imine (PubChem CID 135815410) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbut-2-enyl)-3,5-dihydropurin-6-imine.
| Compound Name | 2-chloro-N-(3-methylbut-2-enyl)-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135815410 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-chloro-N-(3-methylbut-2-enyl)-3,5-dihydropurin-6-imine |
| SMILES | CC(C)=CC/N=C1\N=C(Cl)NC2=NC=NC21 |
| InChI | InChI=1S/C10H12ClN5/c1-6(2)3-4-12-8-7-9(14-5-13-7)16-10(11)15-8/h3,5,7H,4H2,1-2H3,(H,12,13,14,15,16) |
| InChIKey | UHYVHYLZBZTUHW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|