C10H15N5 — CID 162976881
(4S,5S)-N-(3-methylbut-2-enyl)-1,4,5,7-tetrahydropurin-6-imine (PubChem CID 162976881) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is (4S,5S)-N-(3-methylbut-2-enyl)-1,4,5,7-tetrahydropurin-6-imine.
| Compound Name | (4S,5S)-N-(3-methylbut-2-enyl)-1,4,5,7-tetrahydropurin-6-imine |
|---|---|
| PubChem CID | 162976881 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (4S,5S)-N-(3-methylbut-2-enyl)-1,4,5,7-tetrahydropurin-6-imine |
| SMILES | CC(C)=CC/N=C1\NC=N[C@@H]2N=CN[C@H]12 |
| InChI | InChI=1S/C10H15N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6,8,10H,4H2,1-2H3,(H,12,13)(H,11,14,15)/t8-,10+/m1/s1 |
| InChIKey | DIMSEFDETYWFFK-SCZZXKLOSA-N |
| XLogP | 0.31 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|