C10H13N5 — CID 135747565
N-(3-methylbut-3-enyl)-3,5-dihydropurin-6-imine (PubChem CID 135747565) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-(3-methylbut-3-enyl)-3,5-dihydropurin-6-imine.
| Compound Name | N-(3-methylbut-3-enyl)-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135747565 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(3-methylbut-3-enyl)-3,5-dihydropurin-6-imine |
| SMILES | C=C(C)CC/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C10H13N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h5-6,8H,1,3-4H2,2H3,(H,11,12,13,14,15) |
| InChIKey | JHWZCGABTVOAMN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|