C9H13N5 — CID 135754507
N-butyl-3,5-dihydropurin-6-imine (PubChem CID 135754507) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N-butyl-3,5-dihydropurin-6-imine.
| Compound Name | N-butyl-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135754507 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-butyl-3,5-dihydropurin-6-imine |
| SMILES | CCCC/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C9H13N5/c1-2-3-4-10-8-7-9(12-5-11-7)14-6-13-8/h5-7H,2-4H2,1H3,(H,10,11,12,13,14) |
| InChIKey | BICUIKOLIAPCGV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|