C11H17N5 — CID 135921192
N-cyclopentyl-9-methyl-4,5-dihydro-1H-purin-6-imine (PubChem CID 135921192) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is N-cyclopentyl-9-methyl-4,5-dihydro-1H-purin-6-imine.
| Compound Name | N-cyclopentyl-9-methyl-4,5-dihydro-1H-purin-6-imine |
|---|---|
| PubChem CID | 135921192 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-cyclopentyl-9-methyl-4,5-dihydro-1H-purin-6-imine |
| SMILES | CN1C=NC2/C(=N/C3CCCC3)NC=NC21 |
| InChI | InChI=1S/C11H17N5/c1-16-7-14-9-10(12-6-13-11(9)16)15-8-4-2-3-5-8/h6-9,11H,2-5H2,1H3,(H,12,13,15) |
| InChIKey | QIXIBVNYHPVTHM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|