C10H12F3N5 — CID 135747511
N-butyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine (PubChem CID 135747511) has the molecular formula C10H12F3N5 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-butyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine.
| Compound Name | N-butyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135747511 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-butyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine |
| SMILES | CCCC/N=C1\N=C(C(F)(F)F)NC2=NC=NC21 |
| InChI | InChI=1S/C10H12F3N5/c1-2-3-4-14-7-6-8(16-5-15-6)18-9(17-7)10(11,12)13/h5-6H,2-4H2,1H3,(H,14,15,16,17,18) |
| InChIKey | JLEWUAKULPOORG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|