C15H21N5 — CID 135573540
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydropurin-6-imine (PubChem CID 135573540) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydropurin-6-imine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135573540 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydropurin-6-imine |
| SMILES | CC(C)=CCC/C(C)=C/C/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C15H21N5/c1-11(2)5-4-6-12(3)7-8-16-14-13-15(18-9-17-13)20-10-19-14/h5,7,9-10,13H,4,6,8H2,1-3H3,(H,16,17,18,19,20)/b12-7+ |
| InChIKey | IUBVWSSCYBZFOL-KPKJPENVSA-N |
| XLogP | 2.52 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|