C15H27N3 — CID 91571202
N-[8-(2-ethyl-4,5-dihydro-1H-imidazol-5-yl)-6-methyloct-5-en-3-yl]methanimine (PubChem CID 91571202) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[8-(2-ethyl-4,5-dihydro-1H-imidazol-5-yl)-6-methyloct-5-en-3-yl]methanimine.
| Compound Name | N-[8-(2-ethyl-4,5-dihydro-1H-imidazol-5-yl)-6-methyloct-5-en-3-yl]methanimine |
|---|---|
| PubChem CID | 91571202 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-[8-(2-ethyl-4,5-dihydro-1H-imidazol-5-yl)-6-methyloct-5-en-3-yl]methanimine |
| SMILES | C=NC(CC)CC=C(C)CCC1CN=C(CC)N1 |
| InChI | InChI=1S/C15H27N3/c1-5-13(16-4)9-7-12(3)8-10-14-11-17-15(6-2)18-14/h7,13-14H,4-6,8-11H2,1-3H3,(H,17,18) |
| InChIKey | DSAGPBFJMUVKAQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|