C13H15N5 — CID 135737396
N-[(5-methylcyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine (PubChem CID 135737396) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is N-[(5-methylcyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine.
| Compound Name | N-[(5-methylcyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135737396 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(5-methylcyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine |
| SMILES | CC1=CCC=C(C/N=C2\N=CNC3=NC=NC32)C1 |
| InChI | InChI=1S/C13H15N5/c1-9-3-2-4-10(5-9)6-14-12-11-13(16-7-15-11)18-8-17-12/h3-4,7-8,11H,2,5-6H2,1H3,(H,14,15,16,17,18) |
| InChIKey | MUSGFCVLCUIOLT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|