C8H9N5 — CID 135754506
N-prop-2-enyl-3,5-dihydropurin-6-imine (PubChem CID 135754506) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is N-prop-2-enyl-3,5-dihydropurin-6-imine.
| Compound Name | N-prop-2-enyl-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135754506 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-prop-2-enyl-3,5-dihydropurin-6-imine |
| SMILES | C=CC/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C8H9N5/c1-2-3-9-7-6-8(11-4-10-6)13-5-12-7/h2,4-6H,1,3H2,(H,9,10,11,12,13) |
| InChIKey | QKMZBVNPJHCWMX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|