C12H22N3+ — CID 88847086
N-[2-(4-methyl-3-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium-2-yl)ethyl]prop-2-en-1-amine (PubChem CID 88847086) has the molecular formula C12H22N3+ and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[2-(4-methyl-3-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium-2-yl)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(4-methyl-3-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium-2-yl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 88847086 |
| Molecular Formula | C12H22N3+ |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | N-[2-(4-methyl-3-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium-2-yl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCC1=[N+](CC=C)C(C)CN1 |
| InChI | InChI=1S/C12H21N3/c1-4-7-13-8-6-12-14-10-11(3)15(12)9-5-2/h4-5,11,13H,1-2,6-10H2,3H3/p+1 |
| InChIKey | MLAYFVHYPDTTCE-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|