C16H13ClF2N2O4 — CID 135818048
4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethyliminomethyl]-6-nitrophenol (PubChem CID 135818048) has the molecular formula C16H13ClF2N2O4 and a molecular weight of 370.74 g/mol. Its IUPAC name is 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethyliminomethyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethyliminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135818048 |
| Molecular Formula | C16H13ClF2N2O4 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethyliminomethyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N/CCc2ccc(OC(F)F)cc2)c1O |
| InChI | InChI=1S/C16H13ClF2N2O4/c17-12-7-11(15(22)14(8-12)21(23)24)9-20-6-5-10-1-3-13(4-2-10)25-16(18)19/h1-4,7-9,16,22H,5-6H2/b20-9+ |
| InChIKey | LOLJUSRXYHVCQE-AWQFTUOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|