C16H12N2O — CID 135818270
1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol (PubChem CID 135818270) has the molecular formula C16H12N2O and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135818270 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol |
| SMILES | [2H]c1c([2H])c([2H])c(/N=N/c2c(O)ccc3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C16H12N2O/c19-15-11-10-12-6-4-5-9-14(12)16(15)18-17-13-7-2-1-3-8-13/h1-11,19H/b18-17+/i1D,2D,3D,7D,8D |
| InChIKey | MRQIXHXHHPWVIL-BWDNVODCSA-N |
| XLogP | 4.96 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|