About 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol
1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol (PubChem CID 22830) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol |
| PubChem CID | 22830 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol |
| SMILES | COc1ccc(OC)c(/N=N/c2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C18H16N2O3/c1-22-13-8-10-17(23-2)15(11-13)19-20-18-14-6-4-3-5-12(14)7-9-16(18)21/h3-11,21H,1-2H3/b20-19+ |
| InChIKey | GJUABKCEXOMRPQ-FMQUCBEESA-N |
| XLogP | 4.98 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol?
The IUPAC name of 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol (CID 22830) is 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol.
What is the SMILES notation for 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol?
The canonical SMILES for 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol is COc1ccc(OC)c(/N=N/c2c(O)ccc3ccccc23)c1.
What is the InChIKey of 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol?
The InChIKey is GJUABKCEXOMRPQ-FMQUCBEESA-N. The full InChI is InChI=1S/C18H16N2O3/c1-22-13-8-10-17(23-2)15(11-13)19-20-18-14-6-4-3-5-12(14)7-9-16(18)21/h3-11,21H,1-2H3/b20-19+.
What are the key properties of 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol?
1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol has a molecular weight of 308.34 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dimethoxyphenyl)diazenyl]naphthalen-2-ol is sourced from PubChem (CID 22830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).