About 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol
1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol (PubChem CID 6823) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol |
| PubChem CID | 6823 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol |
| SMILES | Cc1ccc(C)c(/N=N/c2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C18H16N2O/c1-12-7-8-13(2)16(11-12)19-20-18-15-6-4-3-5-14(15)9-10-17(18)21/h3-11,21H,1-2H3/b20-19+ |
| InChIKey | VUSAIZBVVMZCCH-FMQUCBEESA-N |
| XLogP | 5.58 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol?
The IUPAC name of 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol (CID 6823) is 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol.
What is the SMILES notation for 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol?
The canonical SMILES for 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol is Cc1ccc(C)c(/N=N/c2c(O)ccc3ccccc23)c1.
What is the InChIKey of 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol?
The InChIKey is VUSAIZBVVMZCCH-FMQUCBEESA-N. The full InChI is InChI=1S/C18H16N2O/c1-12-7-8-13(2)16(11-12)19-20-18-15-6-4-3-5-14(15)9-10-17(18)21/h3-11,21H,1-2H3/b20-19+.
What are the key properties of 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol?
1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol has a molecular weight of 276.34 g/mol, XLogP of 5.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dimethylphenyl)diazenyl]naphthalen-2-ol is sourced from PubChem (CID 6823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).