C25H30N6 — CID 135820201
3-[6-(4-cyclohexylpiperazin-1-yl)-1H-benzimidazol-2-yl]-5-methyl-1H-indazole (PubChem CID 135820201) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-[6-(4-cyclohexylpiperazin-1-yl)-1H-benzimidazol-2-yl]-5-methyl-1H-indazole.
| Compound Name | 3-[6-(4-cyclohexylpiperazin-1-yl)-1H-benzimidazol-2-yl]-5-methyl-1H-indazole |
|---|---|
| PubChem CID | 135820201 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-[6-(4-cyclohexylpiperazin-1-yl)-1H-benzimidazol-2-yl]-5-methyl-1H-indazole |
| SMILES | Cc1ccc2[nH]nc(-c3nc4ccc(N5CCN(C6CCCCC6)CC5)cc4[nH]3)c2c1 |
| InChI | InChI=1S/C25H30N6/c1-17-7-9-21-20(15-17)24(29-28-21)25-26-22-10-8-19(16-23(22)27-25)31-13-11-30(12-14-31)18-5-3-2-4-6-18/h7-10,15-16,18H,2-6,11-14H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | GUAXUXSJEIHRRH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |