C20H19N7 — CID 135820452
3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazole-6-carbonitrile (PubChem CID 135820452) has the molecular formula C20H19N7 and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazole-6-carbonitrile.
| Compound Name | 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazole-6-carbonitrile |
|---|---|
| PubChem CID | 135820452 |
| Molecular Formula | C20H19N7 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazole-6-carbonitrile |
| SMILES | CN1CCN(c2ccc3nc(-c4n[nH]c5cc(C#N)ccc45)[nH]c3c2)CC1 |
| InChI | InChI=1S/C20H19N7/c1-26-6-8-27(9-7-26)14-3-5-16-18(11-14)23-20(22-16)19-15-4-2-13(12-21)10-17(15)24-25-19/h2-5,10-11H,6-9H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HCYKXYPMZFNKPM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |