C21H18N6O — CID 135820215
2-(5-methoxy-1H-indazol-3-yl)-N-(pyridin-2-ylmethyl)-3H-benzimidazol-5-amine (PubChem CID 135820215) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indazol-3-yl)-N-(pyridin-2-ylmethyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(5-methoxy-1H-indazol-3-yl)-N-(pyridin-2-ylmethyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 135820215 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(5-methoxy-1H-indazol-3-yl)-N-(pyridin-2-ylmethyl)-3H-benzimidazol-5-amine |
| SMILES | COc1ccc2[nH]nc(-c3nc4ccc(NCc5ccccn5)cc4[nH]3)c2c1 |
| InChI | InChI=1S/C21H18N6O/c1-28-15-6-8-17-16(11-15)20(27-26-17)21-24-18-7-5-13(10-19(18)25-21)23-12-14-4-2-3-9-22-14/h2-11,23H,12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | YUBQLCKTQKGIBA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |