C20H15ClN6 — CID 135820219
2-(5-chloro-1H-indazol-3-yl)-N-(pyridin-4-ylmethyl)-3H-benzimidazol-5-amine (PubChem CID 135820219) has the molecular formula C20H15ClN6 and a molecular weight of 374.84 g/mol. Its IUPAC name is 2-(5-chloro-1H-indazol-3-yl)-N-(pyridin-4-ylmethyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(5-chloro-1H-indazol-3-yl)-N-(pyridin-4-ylmethyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 135820219 |
| Molecular Formula | C20H15ClN6 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(5-chloro-1H-indazol-3-yl)-N-(pyridin-4-ylmethyl)-3H-benzimidazol-5-amine |
| SMILES | Clc1ccc2[nH]nc(-c3nc4ccc(NCc5ccncc5)cc4[nH]3)c2c1 |
| InChI | InChI=1S/C20H15ClN6/c21-13-1-3-16-15(9-13)19(27-26-16)20-24-17-4-2-14(10-18(17)25-20)23-11-12-5-7-22-8-6-12/h1-10,23H,11H2,(H,24,25)(H,26,27) |
| InChIKey | CHSCJDGOWSIJDL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |