C24H22N8O3 — CID 135820279
3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-4-[(5-nitro-2-pyridinyl)oxy]-1H-indazole (PubChem CID 135820279) has the molecular formula C24H22N8O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-4-[(5-nitro-2-pyridinyl)oxy]-1H-indazole.
| Compound Name | 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-4-[(5-nitro-2-pyridinyl)oxy]-1H-indazole |
|---|---|
| PubChem CID | 135820279 |
| Molecular Formula | C24H22N8O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-4-[(5-nitro-2-pyridinyl)oxy]-1H-indazole |
| SMILES | CN1CCN(c2ccc3nc(-c4n[nH]c5cccc(Oc6ccc([N+](=O)[O-])cn6)c45)[nH]c3c2)CC1 |
| InChI | InChI=1S/C24H22N8O3/c1-30-9-11-31(12-10-30)15-5-7-17-19(13-15)27-24(26-17)23-22-18(28-29-23)3-2-4-20(22)35-21-8-6-16(14-25-21)32(33)34/h2-8,13-14H,9-12H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | XNMNFZURXFXWGO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|