C22H24N6O2 — CID 135820553
2-(1H-[1,3]dioxolo[4,5-f]indazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)-3H-benzimidazol-5-amine (PubChem CID 135820553) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(1H-[1,3]dioxolo[4,5-f]indazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(1H-[1,3]dioxolo[4,5-f]indazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 135820553 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(1H-[1,3]dioxolo[4,5-f]indazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)-3H-benzimidazol-5-amine |
| SMILES | c1cc2nc(-c3n[nH]c4cc5c(cc34)OCO5)[nH]c2cc1NCCCN1CCCC1 |
| InChI | InChI=1S/C22H24N6O2/c1-2-8-28(7-1)9-3-6-23-14-4-5-16-18(10-14)25-22(24-16)21-15-11-19-20(30-13-29-19)12-17(15)26-27-21/h4-5,10-12,23H,1-3,6-9,13H2,(H,24,25)(H,26,27) |
| InChIKey | WBKDVYLEEJIUIR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|