C20H23N3O3S — CID 135822119
N-[(E)-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 135822119) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[(E)-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135822119 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[(E)-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/c2cc3c4c(c2O)CCCN4CCC3)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-14-6-8-17(9-7-14)27(25,26)22-21-13-16-12-15-4-2-10-23-11-3-5-18(19(15)23)20(16)24/h6-9,12-13,22,24H,2-5,10-11H2,1H3/b21-13+ |
| InChIKey | DJQRRPNEMHROLM-FYJGNVAPSA-N |
| XLogP | 2.71 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|