C14H20N4O4S — CID 135822145
2-(dimethylsulfamoylamino)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide (PubChem CID 135822145) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(dimethylsulfamoylamino)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135822145 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
| SMILES | C=CCc1cccc(/C=N/NC(=O)CNS(=O)(=O)N(C)C)c1O |
| InChI | InChI=1S/C14H20N4O4S/c1-4-6-11-7-5-8-12(14(11)20)9-15-17-13(19)10-16-23(21,22)18(2)3/h4-5,7-9,16,20H,1,6,10H2,2-3H3,(H,17,19)/b15-9+ |
| InChIKey | VGNNAYIMAMJFTG-OQLLNIDSSA-N |
| XLogP | -0.03 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|